C7H9N2Rh- — CID 156844690
rhodium;2,5,6-trimethyl-4H-pyrimidin-4-ide (PubChem CID 156844690) has the molecular formula C7H9N2Rh- and a molecular weight of 224.07 g/mol. Its IUPAC name is rhodium;2,5,6-trimethyl-4H-pyrimidin-4-ide.
| Compound Name | rhodium;2,5,6-trimethyl-4H-pyrimidin-4-ide |
|---|---|
| PubChem CID | 156844690 |
| Molecular Formula | C7H9N2Rh- |
| Molecular Weight | 224.07 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | rhodium;2,5,6-trimethyl-4H-pyrimidin-4-ide |
| SMILES | Cc1n[c-]c(C)c(C)n1.[Rh] |
| InChI | InChI=1S/C7H9N2.Rh/c1-5-4-8-7(3)9-6(5)2;/h1-3H3;/q-1; |
| InChIKey | ODTWBZNMDZECHQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.07 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|