C9H15N2+ — CID 59997627
1,2,3,5,6-pentamethyl-4H-pyrimidine-1,3-diium-4-ide (PubChem CID 59997627) has the molecular formula C9H15N2+ and a molecular weight of 151.23 g/mol. Its IUPAC name is 1,2,3,5,6-pentamethyl-4H-pyrimidine-1,3-diium-4-ide.
| Compound Name | 1,2,3,5,6-pentamethyl-4H-pyrimidine-1,3-diium-4-ide |
|---|---|
| PubChem CID | 59997627 |
| Molecular Formula | C9H15N2+ |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.12 |
| IUPAC Name | 1,2,3,5,6-pentamethyl-4H-pyrimidine-1,3-diium-4-ide |
| SMILES | Cc1[c-][n+](C)c(C)[n+](C)c1C |
| InChI | InChI=1S/C9H15N2/c1-7-6-10(4)9(3)11(5)8(7)2/h1-5H3/q+1 |
| InChIKey | RLMMFOAOKYTZAI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|