C9H15N2Rb+2 — CID 59997626
1,2,3,5,6-pentamethyl-4H-pyrimidine-1,3-diium-4-ide;rubidium(1+) (PubChem CID 59997626) has the molecular formula C9H15N2Rb+2 and a molecular weight of 236.70 g/mol. Its IUPAC name is 1,2,3,5,6-pentamethyl-4H-pyrimidine-1,3-diium-4-ide;rubidium(1+).
| Compound Name | 1,2,3,5,6-pentamethyl-4H-pyrimidine-1,3-diium-4-ide;rubidium(1+) |
|---|---|
| PubChem CID | 59997626 |
| Molecular Formula | C9H15N2Rb+2 |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 1,2,3,5,6-pentamethyl-4H-pyrimidine-1,3-diium-4-ide;rubidium(1+) |
| SMILES | Cc1[c-][n+](C)c(C)[n+](C)c1C.[Rb+] |
| InChI | InChI=1S/C9H15N2.Rb/c1-7-6-10(4)9(3)11(5)8(7)2;/h1-5H3;/q2*+1 |
| InChIKey | JLFMSCNOQUDIOB-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|