C8H12N2 — CID 20800963
1,4,5,6-tetramethyl-2H-pyrimidin-1-ium-2-ide (PubChem CID 20800963) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 1,4,5,6-tetramethyl-2H-pyrimidin-1-ium-2-ide.
| Compound Name | 1,4,5,6-tetramethyl-2H-pyrimidin-1-ium-2-ide |
|---|---|
| PubChem CID | 20800963 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 1,4,5,6-tetramethyl-2H-pyrimidin-1-ium-2-ide |
| SMILES | Cc1n[c-][n+](C)c(C)c1C |
| InChI | InChI=1S/C8H12N2/c1-6-7(2)9-5-10(4)8(6)3/h1-4H3 |
| InChIKey | YWRCCJTWIRZTLT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|