C8H13N3 — CID 123409104
1,4,5,6-tetramethylpyrimidin-2-imine (PubChem CID 123409104) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 1,4,5,6-tetramethylpyrimidin-2-imine.
| Compound Name | 1,4,5,6-tetramethylpyrimidin-2-imine |
|---|---|
| PubChem CID | 123409104 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1,4,5,6-tetramethylpyrimidin-2-imine |
| SMILES | [H]/N=c1\nc(C)c(C)c(C)n1C |
| InChI | InChI=1S/C8H13N3/c1-5-6(2)10-8(9)11(4)7(5)3/h9H,1-4H3/b9-8+ |
| InChIKey | LJMGYNMJDMDOOJ-CMDGGOBGSA-N |
| XLogP | 0.82 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |