C11H26N2 — CID 160978603
methane;(Z)-N,N,3-trimethyl-4-methyliminopent-2-en-2-amine (PubChem CID 160978603) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is methane;(Z)-N,N,3-trimethyl-4-methyliminopent-2-en-2-amine.
| Compound Name | methane;(Z)-N,N,3-trimethyl-4-methyliminopent-2-en-2-amine |
|---|---|
| PubChem CID | 160978603 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | methane;(Z)-N,N,3-trimethyl-4-methyliminopent-2-en-2-amine |
| SMILES | C.C.C/N=C(C)/C(C)=C(/C)N(C)C |
| InChI | InChI=1S/C9H18N2.2CH4/c1-7(8(2)10-4)9(3)11(5)6;;/h1-6H3;2*1H4/b9-7-,10-8+;; |
| InChIKey | SZFBNKCWSRUJKR-ZVZOOREZSA-N |
| XLogP | 3.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|