C8H16N2 — CID 59955793
N,3-dimethyl-4-methyliminopent-2-en-2-amine (PubChem CID 59955793) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is N,3-dimethyl-4-methyliminopent-2-en-2-amine.
| Compound Name | N,3-dimethyl-4-methyliminopent-2-en-2-amine |
|---|---|
| PubChem CID | 59955793 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | N,3-dimethyl-4-methyliminopent-2-en-2-amine |
| SMILES | C/N=C(\C)C(C)=C(C)NC |
| InChI | InChI=1S/C8H16N2/c1-6(7(2)9-4)8(3)10-5/h9H,1-5H3/b7-6?,10-8+ |
| InChIKey | FOGFCGTWIGCISK-NACQSJNXSA-N |
| XLogP | 1.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|