C10H20N2 — CID 139818258
N,N-dimethyl-N'-(3-methylpent-2-en-2-yl)ethanimidamide (PubChem CID 139818258) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N,N-dimethyl-N'-(3-methylpent-2-en-2-yl)ethanimidamide.
| Compound Name | N,N-dimethyl-N'-(3-methylpent-2-en-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 139818258 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N,N-dimethyl-N'-(3-methylpent-2-en-2-yl)ethanimidamide |
| SMILES | CCC(C)=C(C)/N=C(\C)N(C)C |
| InChI | InChI=1S/C10H20N2/c1-7-8(2)9(3)11-10(4)12(5)6/h7H2,1-6H3/b9-8?,11-10+ |
| InChIKey | BLZAAPKZPKZINM-VVKPDYKWSA-N |
| XLogP | 2.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|