C10H18N2 — CID 154973119
N'-[(E)-3,4-dimethylpent-2-en-2-yl]-N-methylideneethanimidamide (PubChem CID 154973119) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N'-[(E)-3,4-dimethylpent-2-en-2-yl]-N-methylideneethanimidamide.
| Compound Name | N'-[(E)-3,4-dimethylpent-2-en-2-yl]-N-methylideneethanimidamide |
|---|---|
| PubChem CID | 154973119 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N'-[(E)-3,4-dimethylpent-2-en-2-yl]-N-methylideneethanimidamide |
| SMILES | C=N/C(C)=N/C(C)=C(\C)C(C)C |
| InChI | InChI=1S/C10H18N2/c1-7(2)8(3)9(4)12-10(5)11-6/h7H,6H2,1-5H3/b9-8+,12-10+ |
| InChIKey | SXMLSUXUOQXPJM-CDKJVOIVSA-N |
| XLogP | 3.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|