C8H15N3 — CID 155041471
N'-(C,N-dimethylcarbonimidoyl)-2-methyl-N-methylidenepropanimidamide (PubChem CID 155041471) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is N'-(C,N-dimethylcarbonimidoyl)-2-methyl-N-methylidenepropanimidamide.
| Compound Name | N'-(C,N-dimethylcarbonimidoyl)-2-methyl-N-methylidenepropanimidamide |
|---|---|
| PubChem CID | 155041471 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N'-(C,N-dimethylcarbonimidoyl)-2-methyl-N-methylidenepropanimidamide |
| SMILES | C=N/C(=N\C(C)=N\C)C(C)C |
| InChI | InChI=1S/C8H15N3/c1-6(2)8(10-5)11-7(3)9-4/h6H,5H2,1-4H3/b9-7+,11-8- |
| InChIKey | VFJLHJBJTZDQIE-BGZVTZOUSA-N |
| XLogP | 1.79 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|