C8H13N3O — CID 166894165
prop-2-enyl N'-(C,N-dimethylcarbonimidoyl)-N-methylidenecarbamimidate (PubChem CID 166894165) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is prop-2-enyl N'-(C,N-dimethylcarbonimidoyl)-N-methylidenecarbamimidate.
| Compound Name | prop-2-enyl N'-(C,N-dimethylcarbonimidoyl)-N-methylidenecarbamimidate |
|---|---|
| PubChem CID | 166894165 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | prop-2-enyl N'-(C,N-dimethylcarbonimidoyl)-N-methylidenecarbamimidate |
| SMILES | C=CCO/C(N=C)=N\C(C)=N\C |
| InChI | InChI=1S/C8H13N3O/c1-5-6-12-8(10-4)11-7(2)9-3/h5H,1,4,6H2,2-3H3/b9-7+,11-8- |
| InChIKey | KRMZJQVHRRGZAR-BGZVTZOUSA-N |
| XLogP | 1.29 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|