About ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate
ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate (PubChem CID 143077903) has the molecular formula C18H28N2O3
and a molecular weight of 320.43 g/mol. Its IUPAC name is ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate.
Molecular Properties
| Compound Name | ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate |
| PubChem CID | 143077903 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate |
| SMILES | C=C.C=C.C=CCOC(=C)/N=C(\N=C(/C)OCC=C)OCC=C |
| InChI | InChI=1S/C14H20N2O3.2C2H4/c1-6-9-17-12(4)15-14(19-11-8-3)16-13(5)18-10-7-2;2*1-2/h6-8H,1-4,9-11H2,5H3;2*1-2H2/b15-14+,16-13+;; |
| InChIKey | WAHZGVYBUXZHHD-BZRJERGESA-N |
| XLogP | 4.44 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate?
The IUPAC name of ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate (CID 143077903) is ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate.
What is the SMILES notation for ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate?
The canonical SMILES for ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate is C=C.C=C.C=CCOC(=C)/N=C(\N=C(/C)OCC=C)OCC=C.
What is the InChIKey of ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate?
The InChIKey is WAHZGVYBUXZHHD-BZRJERGESA-N. The full InChI is InChI=1S/C14H20N2O3.2C2H4/c1-6-9-17-12(4)15-14(19-11-8-3)16-13(5)18-10-7-2;2*1-2/h6-8H,1-4,9-11H2,5H3;2*1-2H2/b15-14+,16-13+;;.
What are the key properties of ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate?
ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate has a molecular weight of 320.43 g/mol, XLogP of 4.44, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;prop-2-enyl (1E)-N-[(E)-C-prop-2-enoxy-N-(1-prop-2-enoxyethenyl)carbonimidoyl]ethanimidate is sourced from PubChem (CID 143077903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).