C5H9IN2 — CID 135129023
N-(C,N-dimethylcarbonimidoyl)ethanimidoyl iodide (PubChem CID 135129023) has the molecular formula C5H9IN2 and a molecular weight of 224.04 g/mol. Its IUPAC name is N-(C,N-dimethylcarbonimidoyl)ethanimidoyl iodide.
| Compound Name | N-(C,N-dimethylcarbonimidoyl)ethanimidoyl iodide |
|---|---|
| PubChem CID | 135129023 |
| Molecular Formula | C5H9IN2 |
| Molecular Weight | 224.04 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | N-(C,N-dimethylcarbonimidoyl)ethanimidoyl iodide |
| SMILES | C/N=C(C)/N=C(\C)I |
| InChI | InChI=1S/C5H9IN2/c1-4(6)8-5(2)7-3/h1-3H3/b7-5+,8-4+ |
| InChIKey | INYODUBJZRSUDS-JBVHCYJISA-N |
| XLogP | 1.89 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.04 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|