C5H10INP2 — CID 144680139
(Z)-3-iodo-N-methyl-1,2-bis(phosphanyl)but-2-en-1-imine (PubChem CID 144680139) has the molecular formula C5H10INP2 and a molecular weight of 272.99 g/mol. Its IUPAC name is (Z)-3-iodo-N-methyl-1,2-bis(phosphanyl)but-2-en-1-imine.
| Compound Name | (Z)-3-iodo-N-methyl-1,2-bis(phosphanyl)but-2-en-1-imine |
|---|---|
| PubChem CID | 144680139 |
| Molecular Formula | C5H10INP2 |
| Molecular Weight | 272.99 g/mol |
| Exact Mass | 272.93 |
| IUPAC Name | (Z)-3-iodo-N-methyl-1,2-bis(phosphanyl)but-2-en-1-imine |
| SMILES | C/N=C(P)/C(P)=C(\C)I |
| InChI | InChI=1S/C5H10INP2/c1-3(6)4(8)5(9)7-2/h8-9H2,1-2H3/b4-3-,7-5- |
| InChIKey | SYEVPYFRFLNZCV-MRWCJKGFSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.99 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|