About N-methylethanimidoyl isocyanate
N-methylethanimidoyl isocyanate (PubChem CID 173494275) has the molecular formula C4H6N2O
and a molecular weight of 98.10 g/mol. Its IUPAC name is N-methylethanimidoyl isocyanate.
Molecular Properties
| Compound Name | N-methylethanimidoyl isocyanate |
| PubChem CID | 173494275 |
| Molecular Formula | C4H6N2O |
| Molecular Weight | 98.10 g/mol |
| Exact Mass | 98.05 |
| IUPAC Name | N-methylethanimidoyl isocyanate |
| SMILES | C/N=C(\C)N=C=O |
| InChI | InChI=1S/C4H6N2O/c1-4(5-2)6-3-7/h1-2H3/b5-4+ |
| InChIKey | MLCXLWIHQRAIOK-SNAWJCMRSA-N |
| XLogP | 0.37 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.10 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze N-methylethanimidoyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylethanimidoyl isocyanate?
The IUPAC name of N-methylethanimidoyl isocyanate (CID 173494275) is N-methylethanimidoyl isocyanate.
What is the SMILES notation for N-methylethanimidoyl isocyanate?
The canonical SMILES for N-methylethanimidoyl isocyanate is C/N=C(\C)N=C=O.
What is the InChIKey of N-methylethanimidoyl isocyanate?
The InChIKey is MLCXLWIHQRAIOK-SNAWJCMRSA-N. The full InChI is InChI=1S/C4H6N2O/c1-4(5-2)6-3-7/h1-2H3/b5-4+.
What are the key properties of N-methylethanimidoyl isocyanate?
N-methylethanimidoyl isocyanate has a molecular weight of 98.10 g/mol, XLogP of 0.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylethanimidoyl isocyanate is sourced from PubChem (CID 173494275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).