C6H6N2O2 — CID 57309975
1,3-diisocyanatobut-2-ene (PubChem CID 57309975) has the molecular formula C6H6N2O2 and a molecular weight of 138.13 g/mol. Its IUPAC name is 1,3-diisocyanatobut-2-ene.
| Compound Name | 1,3-diisocyanatobut-2-ene |
|---|---|
| PubChem CID | 57309975 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 1,3-diisocyanatobut-2-ene |
| SMILES | CC(=CCN=C=O)N=C=O |
| InChI | InChI=1S/C6H6N2O2/c1-6(8-5-10)2-3-7-4-9/h2H,3H2,1H3 |
| InChIKey | HTCJSLVBLBIOAF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|