About 2-methylhex-2-enoyl isocyanate
2-methylhex-2-enoyl isocyanate (PubChem CID 174509683) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-methylhex-2-enoyl isocyanate.
Molecular Properties
| Compound Name | 2-methylhex-2-enoyl isocyanate |
| PubChem CID | 174509683 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 2-methylhex-2-enoyl isocyanate |
| SMILES | CCCC=C(C)C(=O)N=C=O |
| InChI | InChI=1S/C8H11NO2/c1-3-4-5-7(2)8(11)9-6-10/h5H,3-4H2,1-2H3 |
| InChIKey | ZUCMJHORVLCSIR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhex-2-enoyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhex-2-enoyl isocyanate?
The IUPAC name of 2-methylhex-2-enoyl isocyanate (CID 174509683) is 2-methylhex-2-enoyl isocyanate.
What is the SMILES notation for 2-methylhex-2-enoyl isocyanate?
The canonical SMILES for 2-methylhex-2-enoyl isocyanate is CCCC=C(C)C(=O)N=C=O.
What is the InChIKey of 2-methylhex-2-enoyl isocyanate?
The InChIKey is ZUCMJHORVLCSIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-3-4-5-7(2)8(11)9-6-10/h5H,3-4H2,1-2H3.
What are the key properties of 2-methylhex-2-enoyl isocyanate?
2-methylhex-2-enoyl isocyanate has a molecular weight of 153.18 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhex-2-enoyl isocyanate is sourced from PubChem (CID 174509683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).