About ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine
ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine (PubChem CID 143372757) has the molecular formula C14H36N2
and a molecular weight of 232.46 g/mol. Its IUPAC name is ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine.
Molecular Properties
| Compound Name | ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine |
| PubChem CID | 143372757 |
| Molecular Formula | C14H36N2 |
| Molecular Weight | 232.46 g/mol |
| Exact Mass | 232.29 |
| IUPAC Name | ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine |
| SMILES | C=NC.C=NC(=C)C.CC.CC.CC.CC |
| InChI | InChI=1S/C4H7N.C2H5N.4C2H6/c1-4(2)5-3;1-3-2;4*1-2/h1,3H2,2H3;1H2,2H3;4*1-2H3 |
| InChIKey | GUXWDIPLUFDZOU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine?
The IUPAC name of ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine (CID 143372757) is ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine.
What is the SMILES notation for ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine?
The canonical SMILES for ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine is C=NC.C=NC(=C)C.CC.CC.CC.CC.
What is the InChIKey of ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine?
The InChIKey is GUXWDIPLUFDZOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N.C2H5N.4C2H6/c1-4(2)5-3;1-3-2;4*1-2/h1,3H2,2H3;1H2,2H3;4*1-2H3.
What are the key properties of ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine?
ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine has a molecular weight of 232.46 g/mol, XLogP of 5.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methylmethanimine;N-prop-1-en-2-ylmethanimine is sourced from PubChem (CID 143372757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).