About 2-thionitrosoprop-1-ene
2-thionitrosoprop-1-ene (PubChem CID 173382355) has the molecular formula C3H5NS
and a molecular weight of 87.15 g/mol. Its IUPAC name is 2-thionitrosoprop-1-ene.
Molecular Properties
| Compound Name | 2-thionitrosoprop-1-ene |
| PubChem CID | 173382355 |
| Molecular Formula | C3H5NS |
| Molecular Weight | 87.15 g/mol |
| Exact Mass | 87.01 |
| IUPAC Name | 2-thionitrosoprop-1-ene |
| SMILES | C=C(C)N=S |
| InChI | InChI=1S/C3H5NS/c1-3(2)4-5/h1H2,2H3 |
| InChIKey | FKYOFTZQTNWKIN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.15 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-thionitrosoprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thionitrosoprop-1-ene?
The IUPAC name of 2-thionitrosoprop-1-ene (CID 173382355) is 2-thionitrosoprop-1-ene.
What is the SMILES notation for 2-thionitrosoprop-1-ene?
The canonical SMILES for 2-thionitrosoprop-1-ene is C=C(C)N=S.
What is the InChIKey of 2-thionitrosoprop-1-ene?
The InChIKey is FKYOFTZQTNWKIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NS/c1-3(2)4-5/h1H2,2H3.
What are the key properties of 2-thionitrosoprop-1-ene?
2-thionitrosoprop-1-ene has a molecular weight of 87.15 g/mol, XLogP of 1.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thionitrosoprop-1-ene is sourced from PubChem (CID 173382355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).