C9H18N2 — CID 123235169
N,N-dimethyl-N'-(3-methylpent-2-en-2-yl)methanimidamide (PubChem CID 123235169) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is N,N-dimethyl-N'-(3-methylpent-2-en-2-yl)methanimidamide.
| Compound Name | N,N-dimethyl-N'-(3-methylpent-2-en-2-yl)methanimidamide |
|---|---|
| PubChem CID | 123235169 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N,N-dimethyl-N'-(3-methylpent-2-en-2-yl)methanimidamide |
| SMILES | CCC(C)=C(C)/N=C/N(C)C |
| InChI | InChI=1S/C9H18N2/c1-6-8(2)9(3)10-7-11(4)5/h7H,6H2,1-5H3/b9-8?,10-7+ |
| InChIKey | IYTXPOAZAMWGMX-GLNSQRODSA-N |
| XLogP | 2.28 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|