About N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide
N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide (PubChem CID 166777872) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide.
Molecular Properties
| Compound Name | N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide |
| PubChem CID | 166777872 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide |
| SMILES | C/N=N/C=N/C(=C(C)C)C(C)C |
| InChI | InChI=1S/C9H17N3/c1-7(2)9(8(3)4)11-6-12-10-5/h6-7H,1-5H3/b11-6+,12-10+ |
| InChIKey | DSRAKIQHSAVBKU-BFPRWLMKSA-N |
| XLogP | 3.05 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide?
The IUPAC name of N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide (CID 166777872) is N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide.
What is the SMILES notation for N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide?
The canonical SMILES for N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide is C/N=N/C=N/C(=C(C)C)C(C)C.
What is the InChIKey of N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide?
The InChIKey is DSRAKIQHSAVBKU-BFPRWLMKSA-N. The full InChI is InChI=1S/C9H17N3/c1-7(2)9(8(3)4)11-6-12-10-5/h6-7H,1-5H3/b11-6+,12-10+.
What are the key properties of N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide?
N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide has a molecular weight of 167.26 g/mol, XLogP of 3.05, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,4-dimethylpent-2-en-3-yl)-N-methyliminomethanimidamide is sourced from PubChem (CID 166777872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).