C11H19N2+ — CID 102245435
1,3,4,5,6,7-hexamethyl-1,3-diazepin-1-ium (PubChem CID 102245435) has the molecular formula C11H19N2+ and a molecular weight of 179.29 g/mol. Its IUPAC name is 1,3,4,5,6,7-hexamethyl-1,3-diazepin-1-ium.
| Compound Name | 1,3,4,5,6,7-hexamethyl-1,3-diazepin-1-ium |
|---|---|
| PubChem CID | 102245435 |
| Molecular Formula | C11H19N2+ |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.15 |
| IUPAC Name | 1,3,4,5,6,7-hexamethyl-1,3-diazepin-1-ium |
| SMILES | CC1=C(C)N(C)C=[N+](C)C(C)=C1C |
| InChI | InChI=1S/C11H19N2/c1-8-9(2)11(4)13(6)7-12(5)10(8)3/h7H,1-6H3/q+1 |
| InChIKey | LJGYHTICKHWLNT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|