C10H16N2 — CID 159760374
(6Z)-1,4,5-trimethyl-6-propylidenepyrimidine (PubChem CID 159760374) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (6Z)-1,4,5-trimethyl-6-propylidenepyrimidine.
| Compound Name | (6Z)-1,4,5-trimethyl-6-propylidenepyrimidine |
|---|---|
| PubChem CID | 159760374 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (6Z)-1,4,5-trimethyl-6-propylidenepyrimidine |
| SMILES | CC/C=C1/C(C)=C(C)N=CN1C |
| InChI | InChI=1S/C10H16N2/c1-5-6-10-8(2)9(3)11-7-12(10)4/h6-7H,5H2,1-4H3/b10-6- |
| InChIKey | NEUKKTKAJRHAOS-POHAHGRESA-N |
| XLogP | 2.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |