C10H18N2 — CID 123417471
N-hepta-3,5-dien-3-yl-N,N'-dimethylmethanimidamide (PubChem CID 123417471) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N-hepta-3,5-dien-3-yl-N,N'-dimethylmethanimidamide.
| Compound Name | N-hepta-3,5-dien-3-yl-N,N'-dimethylmethanimidamide |
|---|---|
| PubChem CID | 123417471 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-hepta-3,5-dien-3-yl-N,N'-dimethylmethanimidamide |
| SMILES | CC=CC=C(CC)N(C)/C=N/C |
| InChI | InChI=1S/C10H18N2/c1-5-7-8-10(6-2)12(4)9-11-3/h5,7-9H,6H2,1-4H3/b7-5?,10-8?,11-9+ |
| InChIKey | ULEKHBGIOJXURK-QRKXXVSHSA-N |
| XLogP | 2.45 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|