C9H16N2 — CID 143071601
(3Z)-N,N-dimethyl-3-(methylideneamino)hexa-3,5-dien-1-amine (PubChem CID 143071601) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (3Z)-N,N-dimethyl-3-(methylideneamino)hexa-3,5-dien-1-amine.
| Compound Name | (3Z)-N,N-dimethyl-3-(methylideneamino)hexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 143071601 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (3Z)-N,N-dimethyl-3-(methylideneamino)hexa-3,5-dien-1-amine |
| SMILES | C=C/C=C(/CCN(C)C)N=C |
| InChI | InChI=1S/C9H16N2/c1-5-6-9(10-2)7-8-11(3)4/h5-6H,1-2,7-8H2,3-4H3/b9-6- |
| InChIKey | XNLWIQHOSYGLTE-TWGQIWQCSA-N |
| XLogP | 1.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|