C10H17N — CID 123755759
N,N-dimethylocta-3,5,7-trien-3-amine (PubChem CID 123755759) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N,N-dimethylocta-3,5,7-trien-3-amine.
| Compound Name | N,N-dimethylocta-3,5,7-trien-3-amine |
|---|---|
| PubChem CID | 123755759 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N,N-dimethylocta-3,5,7-trien-3-amine |
| SMILES | C=CC=CC=C(CC)N(C)C |
| InChI | InChI=1S/C10H17N/c1-5-7-8-9-10(6-2)11(3)4/h5,7-9H,1,6H2,2-4H3 |
| InChIKey | NLMYHHJXRUJXGY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|