About methyl-methylidene-nona-3,7-dien-3-ylazanium
methyl-methylidene-nona-3,7-dien-3-ylazanium (PubChem CID 123909848) has the molecular formula C11H20N+
and a molecular weight of 166.29 g/mol. Its IUPAC name is methyl-methylidene-nona-3,7-dien-3-ylazanium.
Molecular Properties
| Compound Name | methyl-methylidene-nona-3,7-dien-3-ylazanium |
| PubChem CID | 123909848 |
| Molecular Formula | C11H20N+ |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.16 |
| IUPAC Name | methyl-methylidene-nona-3,7-dien-3-ylazanium |
| SMILES | C=[N+](C)C(=CCCC=CC)CC |
| InChI | InChI=1S/C11H20N/c1-5-7-8-9-10-11(6-2)12(3)4/h5,7,10H,3,6,8-9H2,1-2,4H3/q+1 |
| InChIKey | MURIXBSSBIVJGN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl-methylidene-nona-3,7-dien-3-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-methylidene-nona-3,7-dien-3-ylazanium?
The IUPAC name of methyl-methylidene-nona-3,7-dien-3-ylazanium (CID 123909848) is methyl-methylidene-nona-3,7-dien-3-ylazanium.
What is the SMILES notation for methyl-methylidene-nona-3,7-dien-3-ylazanium?
The canonical SMILES for methyl-methylidene-nona-3,7-dien-3-ylazanium is C=[N+](C)C(=CCCC=CC)CC.
What is the InChIKey of methyl-methylidene-nona-3,7-dien-3-ylazanium?
The InChIKey is MURIXBSSBIVJGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N/c1-5-7-8-9-10-11(6-2)12(3)4/h5,7,10H,3,6,8-9H2,1-2,4H3/q+1.
What are the key properties of methyl-methylidene-nona-3,7-dien-3-ylazanium?
methyl-methylidene-nona-3,7-dien-3-ylazanium has a molecular weight of 166.29 g/mol, XLogP of 2.98, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-methylidene-nona-3,7-dien-3-ylazanium is sourced from PubChem (CID 123909848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).