C13H21N — CID 126539449
(3E,8Z)-N-ethenyl-N-methyldeca-3,6,8-trien-4-amine (PubChem CID 126539449) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (3E,8Z)-N-ethenyl-N-methyldeca-3,6,8-trien-4-amine.
| Compound Name | (3E,8Z)-N-ethenyl-N-methyldeca-3,6,8-trien-4-amine |
|---|---|
| PubChem CID | 126539449 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (3E,8Z)-N-ethenyl-N-methyldeca-3,6,8-trien-4-amine |
| SMILES | C=CN(C)/C(=C/CC)CC=C/C=C\C |
| InChI | InChI=1S/C13H21N/c1-5-8-9-10-12-13(11-6-2)14(4)7-3/h5,7-11H,3,6,12H2,1-2,4H3/b8-5-,10-9?,13-11+ |
| InChIKey | ZXTCMVYGNDGBFJ-HXVJMDCFSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|