C11H17N — CID 139243578
(4Z,6Z,8Z)-1,3,3-trimethyl-2H-azonine (PubChem CID 139243578) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (4Z,6Z,8Z)-1,3,3-trimethyl-2H-azonine.
| Compound Name | (4Z,6Z,8Z)-1,3,3-trimethyl-2H-azonine |
|---|---|
| PubChem CID | 139243578 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (4Z,6Z,8Z)-1,3,3-trimethyl-2H-azonine |
| SMILES | CN1/C=C\C=C/C=C\C(C)(C)C1 |
| InChI | InChI=1S/C11H17N/c1-11(2)8-6-4-5-7-9-12(3)10-11/h4-9H,10H2,1-3H3/b5-4-,8-6-,9-7- |
| InChIKey | VNXVXDNIVAWVNZ-CBYRLPPOSA-N |
| XLogP | 2.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |