C9H12N4 — CID 12680137
N'-(1,1-dicyanobut-1-en-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 12680137) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is N'-(1,1-dicyanobut-1-en-2-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(1,1-dicyanobut-1-en-2-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 12680137 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | N'-(1,1-dicyanobut-1-en-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CCC(/N=C/N(C)C)=C(C#N)C#N |
| InChI | InChI=1S/C9H12N4/c1-4-9(8(5-10)6-11)12-7-13(2)3/h7H,4H2,1-3H3/b12-7+ |
| InChIKey | DTPZUSZBHBQCTL-KPKJPENVSA-N |
| XLogP | 1.29 |
| TPSA | 63.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|