C12H14N6 — CID 13033117
N,N-dimethyl-N'-[(3Z)-1,1,3-tricyano-4-(dimethylamino)buta-1,3-dien-2-yl]methanimidamide (PubChem CID 13033117) has the molecular formula C12H14N6 and a molecular weight of 242.29 g/mol. Its IUPAC name is N,N-dimethyl-N'-[(3Z)-1,1,3-tricyano-4-(dimethylamino)buta-1,3-dien-2-yl]methanimidamide.
| Compound Name | N,N-dimethyl-N'-[(3Z)-1,1,3-tricyano-4-(dimethylamino)buta-1,3-dien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 13033117 |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N,N-dimethyl-N'-[(3Z)-1,1,3-tricyano-4-(dimethylamino)buta-1,3-dien-2-yl]methanimidamide |
| SMILES | CN(C)/C=C(\C#N)C(/N=C/N(C)C)=C(C#N)C#N |
| InChI | InChI=1S/C12H14N6/c1-17(2)8-11(7-15)12(10(5-13)6-14)16-9-18(3)4/h8-9H,1-4H3/b11-8+,16-9+ |
| InChIKey | KEQQZFMISQTGHX-CCUWFILGSA-N |
| XLogP | 0.85 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|