C10H13N3 — CID 123469360
N'-(4-cyanohexa-1,3,5-trien-3-yl)-N,N-dimethylmethanimidamide (PubChem CID 123469360) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is N'-(4-cyanohexa-1,3,5-trien-3-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(4-cyanohexa-1,3,5-trien-3-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 123469360 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N'-(4-cyanohexa-1,3,5-trien-3-yl)-N,N-dimethylmethanimidamide |
| SMILES | C=CC(C#N)=C(C=C)/N=C/N(C)C |
| InChI | InChI=1S/C10H13N3/c1-5-9(7-11)10(6-2)12-8-13(3)4/h5-6,8H,1-2H2,3-4H3/b10-9?,12-8+ |
| InChIKey | RIFVLEHRRFECDK-QJQJIATLSA-N |
| XLogP | 1.73 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|