About N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide
N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide (PubChem CID 123409351) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide |
| PubChem CID | 123409351 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide |
| SMILES | C=CC(/N=C/N(C)C)=C(C)C#N |
| InChI | InChI=1S/C9H13N3/c1-5-9(8(2)6-10)11-7-12(3)4/h5,7H,1H2,2-4H3/b9-8?,11-7+ |
| InChIKey | MQAVTKBOPATHEC-CADBOJOXSA-N |
| XLogP | 1.56 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide?
The IUPAC name of N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide (CID 123409351) is N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide is C=CC(/N=C/N(C)C)=C(C)C#N.
What is the InChIKey of N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide?
The InChIKey is MQAVTKBOPATHEC-CADBOJOXSA-N. The full InChI is InChI=1S/C9H13N3/c1-5-9(8(2)6-10)11-7-12(3)4/h5,7H,1H2,2-4H3/b9-8?,11-7+.
What are the key properties of N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide?
N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide has a molecular weight of 163.22 g/mol, XLogP of 1.56, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-cyanopenta-1,3-dien-3-yl)-N,N-dimethylmethanimidamide is sourced from PubChem (CID 123409351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).