About N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide
N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide (PubChem CID 78146426) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide |
| PubChem CID | 78146426 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide |
| SMILES | CCC(/N=C(\C)N(C)C)=C(C)C#N |
| InChI | InChI=1S/C10H17N3/c1-6-10(8(2)7-11)12-9(3)13(4)5/h6H2,1-5H3/b10-8?,12-9+ |
| InChIKey | AIGZVQHTUOMPPE-AVZJTKQCSA-N |
| XLogP | 2.17 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide?
The IUPAC name of N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide (CID 78146426) is N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide.
What is the SMILES notation for N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide?
The canonical SMILES for N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide is CCC(/N=C(\C)N(C)C)=C(C)C#N.
What is the InChIKey of N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide?
The InChIKey is AIGZVQHTUOMPPE-AVZJTKQCSA-N. The full InChI is InChI=1S/C10H17N3/c1-6-10(8(2)7-11)12-9(3)13(4)5/h6H2,1-5H3/b10-8?,12-9+.
What are the key properties of N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide?
N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide has a molecular weight of 179.27 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-cyanopent-2-en-3-yl)-N,N-dimethylethanimidamide is sourced from PubChem (CID 78146426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).