C11H21N2Rb — CID 167503041
ethane;rubidium(1+);2,5,6-trimethyl-4H-pyrimidin-4-ide (PubChem CID 167503041) has the molecular formula C11H21N2Rb and a molecular weight of 266.77 g/mol. Its IUPAC name is ethane;rubidium(1+);2,5,6-trimethyl-4H-pyrimidin-4-ide.
| Compound Name | ethane;rubidium(1+);2,5,6-trimethyl-4H-pyrimidin-4-ide |
|---|---|
| PubChem CID | 167503041 |
| Molecular Formula | C11H21N2Rb |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | ethane;rubidium(1+);2,5,6-trimethyl-4H-pyrimidin-4-ide |
| SMILES | CC.CC.Cc1n[c-]c(C)c(C)n1.[Rb+] |
| InChI | InChI=1S/C7H9N2.2C2H6.Rb/c1-5-4-8-7(3)9-6(5)2;2*1-2;/h1-3H3;2*1-2H3;/q-1;;;+1 |
| InChIKey | RPGUWJKMSMJTTN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|