C6H8N3Y- — CID 58291655
4,6-dimethyl-5H-pyrimidin-5-id-2-amine;yttrium (PubChem CID 58291655) has the molecular formula C6H8N3Y- and a molecular weight of 211.06 g/mol. Its IUPAC name is 4,6-dimethyl-5H-pyrimidin-5-id-2-amine;yttrium.
| Compound Name | 4,6-dimethyl-5H-pyrimidin-5-id-2-amine;yttrium |
|---|---|
| PubChem CID | 58291655 |
| Molecular Formula | C6H8N3Y- |
| Molecular Weight | 211.06 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | 4,6-dimethyl-5H-pyrimidin-5-id-2-amine;yttrium |
| SMILES | Cc1[c-]c(C)nc(N)n1.[Y] |
| InChI | InChI=1S/C6H8N3.Y/c1-4-3-5(2)9-6(7)8-4;/h1-2H3,(H2,7,8,9);/q-1; |
| InChIKey | VFBKIPYLBUKBQR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.06 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|