C6H7N2Y- — CID 58291708
2-deuterio-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium (PubChem CID 58291708) has the molecular formula C6H7N2Y- and a molecular weight of 197.05 g/mol. Its IUPAC name is 2-deuterio-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium.
| Compound Name | 2-deuterio-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium |
|---|---|
| PubChem CID | 58291708 |
| Molecular Formula | C6H7N2Y- |
| Molecular Weight | 197.05 g/mol |
| Exact Mass | 196.97 |
| IUPAC Name | 2-deuterio-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium |
| SMILES | [2H]c1nc(C)[c-]c(C)n1.[Y] |
| InChI | InChI=1S/C6H7N2.Y/c1-5-3-6(2)8-4-7-5;/h4H,1-2H3;/q-1;/i4D; |
| InChIKey | RRJQJFMTCPUGAW-BCVNIXSYSA-N |
| XLogP | 0.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.05 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|