C6H6N2W4Y-2 — CID 59389610
4,6-dimethyl-2,5-dihydropyrimidine-2,5-diide;tungsten;yttrium (PubChem CID 59389610) has the molecular formula C6H6N2W4Y-2 and a molecular weight of 930.39 g/mol. Its IUPAC name is 4,6-dimethyl-2,5-dihydropyrimidine-2,5-diide;tungsten;yttrium.
| Compound Name | 4,6-dimethyl-2,5-dihydropyrimidine-2,5-diide;tungsten;yttrium |
|---|---|
| PubChem CID | 59389610 |
| Molecular Formula | C6H6N2W4Y-2 |
| Molecular Weight | 930.39 g/mol |
| Exact Mass | 930.76 |
| IUPAC Name | 4,6-dimethyl-2,5-dihydropyrimidine-2,5-diide;tungsten;yttrium |
| SMILES | Cc1[c-]c(C)n[c-]n1.[W].[W].[W].[W].[Y] |
| InChI | InChI=1S/C6H6N2.4W.Y/c1-5-3-6(2)8-4-7-5;;;;;/h1-2H3;;;;;/q-2;;;;; |
| InChIKey | SYGMYYSUKKBKJL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|