About 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium
2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium (PubChem CID 58291715) has the molecular formula C7H9N2OY-
and a molecular weight of 226.07 g/mol. Its IUPAC name is 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium.
Molecular Properties
| Compound Name | 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium |
| PubChem CID | 58291715 |
| Molecular Formula | C7H9N2OY- |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium |
| SMILES | COc1nc(C)[c-]c(C)n1.[Y] |
| InChI | InChI=1S/C7H9N2O.Y/c1-5-4-6(2)9-7(8-5)10-3;/h1-3H3;/q-1; |
| InChIKey | YPGYVUQJIHYTCZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium?
The IUPAC name of 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium (CID 58291715) is 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium.
What is the SMILES notation for 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium?
The canonical SMILES for 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium is COc1nc(C)[c-]c(C)n1.[Y].
What is the InChIKey of 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium?
The InChIKey is YPGYVUQJIHYTCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N2O.Y/c1-5-4-6(2)9-7(8-5)10-3;/h1-3H3;/q-1;.
What are the key properties of 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium?
2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium has a molecular weight of 226.07 g/mol, XLogP of 0.90, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4,6-dimethyl-5H-pyrimidin-5-ide;yttrium is sourced from PubChem (CID 58291715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).