C6H6N2WY-2 — CID 147888570
4,6-dimethyl-2,5-dihydropyrimidine-2,5-diide;tungsten;yttrium (PubChem CID 147888570) has the molecular formula C6H6N2WY-2 and a molecular weight of 378.87 g/mol. Its IUPAC name is 4,6-dimethyl-2,5-dihydropyrimidine-2,5-diide;tungsten;yttrium.
| Compound Name | 4,6-dimethyl-2,5-dihydropyrimidine-2,5-diide;tungsten;yttrium |
|---|---|
| PubChem CID | 147888570 |
| Molecular Formula | C6H6N2WY-2 |
| Molecular Weight | 378.87 g/mol |
| Exact Mass | 378.91 |
| IUPAC Name | 4,6-dimethyl-2,5-dihydropyrimidine-2,5-diide;tungsten;yttrium |
| SMILES | Cc1[c-]c(C)n[c-]n1.[W].[Y] |
| InChI | InChI=1S/C6H6N2.W.Y/c1-5-3-6(2)8-4-7-5;;/h1-2H3;;/q-2;; |
| InChIKey | AERHFAWFWYQEMY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.87 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|