C7H9N2W- — CID 59901002
2,4,6-trimethyl-5H-pyrimidin-5-ide;tungsten (PubChem CID 59901002) has the molecular formula C7H9N2W- and a molecular weight of 305.00 g/mol. Its IUPAC name is 2,4,6-trimethyl-5H-pyrimidin-5-ide;tungsten.
| Compound Name | 2,4,6-trimethyl-5H-pyrimidin-5-ide;tungsten |
|---|---|
| PubChem CID | 59901002 |
| Molecular Formula | C7H9N2W- |
| Molecular Weight | 305.00 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2,4,6-trimethyl-5H-pyrimidin-5-ide;tungsten |
| SMILES | Cc1[c-]c(C)nc(C)n1.[W] |
| InChI | InChI=1S/C7H9N2.W/c1-5-4-6(2)9-7(3)8-5;/h1-3H3;/q-1; |
| InChIKey | DNWSVJQJLQOZIY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.00 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|