C8H9K2N — CID 18712652
dipotassium;3,5,6-trimethyl-2,4-dihydropyridine-2,4-diide (PubChem CID 18712652) has the molecular formula C8H9K2N and a molecular weight of 197.36 g/mol. Its IUPAC name is dipotassium;3,5,6-trimethyl-2,4-dihydropyridine-2,4-diide.
| Compound Name | dipotassium;3,5,6-trimethyl-2,4-dihydropyridine-2,4-diide |
|---|---|
| PubChem CID | 18712652 |
| Molecular Formula | C8H9K2N |
| Molecular Weight | 197.36 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | dipotassium;3,5,6-trimethyl-2,4-dihydropyridine-2,4-diide |
| SMILES | Cc1[c-]nc(C)c(C)[c-]1.[K+].[K+] |
| InChI | InChI=1S/C8H9N.2K/c1-6-4-7(2)8(3)9-5-6;;/h1-3H3;;/q-2;2*+1 |
| InChIKey | RPFVBBHIHLVFQD-UHFFFAOYSA-N |
| XLogP | -4.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.36 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|