C8H10NW+ — CID 18717305
3,5,6-trimethyl-2H-pyridin-2-ide;tungsten(2+) (PubChem CID 18717305) has the molecular formula C8H10NW+ and a molecular weight of 304.02 g/mol. Its IUPAC name is 3,5,6-trimethyl-2H-pyridin-2-ide;tungsten(2+).
| Compound Name | 3,5,6-trimethyl-2H-pyridin-2-ide;tungsten(2+) |
|---|---|
| PubChem CID | 18717305 |
| Molecular Formula | C8H10NW+ |
| Molecular Weight | 304.02 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 3,5,6-trimethyl-2H-pyridin-2-ide;tungsten(2+) |
| SMILES | Cc1[c-]nc(C)c(C)c1.[W+2] |
| InChI | InChI=1S/C8H10N.W/c1-6-4-7(2)8(3)9-5-6;/h4H,1-3H3;/q-1;+2 |
| InChIKey | HVKHZXQHENQHRC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.02 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|