C9H9NRbRe- — CID 59339959
4-ethenyl-3,6-dimethyl-2,5-dihydropyridine-2,5-diide;rhenium;rubidium(1+) (PubChem CID 59339959) has the molecular formula C9H9NRbRe- and a molecular weight of 402.85 g/mol. Its IUPAC name is 4-ethenyl-3,6-dimethyl-2,5-dihydropyridine-2,5-diide;rhenium;rubidium(1+).
| Compound Name | 4-ethenyl-3,6-dimethyl-2,5-dihydropyridine-2,5-diide;rhenium;rubidium(1+) |
|---|---|
| PubChem CID | 59339959 |
| Molecular Formula | C9H9NRbRe- |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | 4-ethenyl-3,6-dimethyl-2,5-dihydropyridine-2,5-diide;rhenium;rubidium(1+) |
| SMILES | C=Cc1[c-]c(C)n[c-]c1C.[Rb+].[Re] |
| InChI | InChI=1S/C9H9N.Rb.Re/c1-4-9-5-8(3)10-6-7(9)2;;/h4H,1H2,2-3H3;;/q-2;+1; |
| InChIKey | MBFBIRRHSZFSJG-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|