C24H19ClN2O5S — CID 118097969
3-[2-chloro-5-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yloxy)phenyl]-2,4-dioxo-1H-thieno[3,4-d]pyrimidine-5-carboxylic acid (PubChem CID 118097969) has the molecular formula C24H19ClN2O5S and a molecular weight of 482.95 g/mol. Its IUPAC name is 3-[2-chloro-5-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yloxy)phenyl]-2,4-dioxo-1H-thieno[3,4-d]pyrimidine-5-carboxylic acid.
| Compound Name | 3-[2-chloro-5-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yloxy)phenyl]-2,4-dioxo-1H-thieno[3,4-d]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 118097969 |
| Molecular Formula | C24H19ClN2O5S |
| Molecular Weight | 482.95 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | 3-[2-chloro-5-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yloxy)phenyl]-2,4-dioxo-1H-thieno[3,4-d]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1scc2[nH]c(=O)n(-c3cc(OC4CCCCc5ccccc54)ccc3Cl)c(=O)c12 |
| InChI | InChI=1S/C24H19ClN2O5S/c25-16-10-9-14(32-19-8-4-2-6-13-5-1-3-7-15(13)19)11-18(16)27-22(28)20-17(26-24(27)31)12-33-21(20)23(29)30/h1,3,5,7,9-12,19H,2,4,6,8H2,(H,26,31)(H,29,30) |
| InChIKey | MCZJSAAGVRZTHE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.95 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |