C14H20F2N2O2 — CID 118098709
ethyl (2R)-2-[4-amino-2-(methylaminomethyl)phenyl]-4,4-difluorobutanoate (PubChem CID 118098709) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is ethyl (2R)-2-[4-amino-2-(methylaminomethyl)phenyl]-4,4-difluorobutanoate.
| Compound Name | ethyl (2R)-2-[4-amino-2-(methylaminomethyl)phenyl]-4,4-difluorobutanoate |
|---|---|
| PubChem CID | 118098709 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | ethyl (2R)-2-[4-amino-2-(methylaminomethyl)phenyl]-4,4-difluorobutanoate |
| SMILES | CCOC(=O)[C@H](CC(F)F)c1ccc(N)cc1CNC |
| InChI | InChI=1S/C14H20F2N2O2/c1-3-20-14(19)12(7-13(15)16)11-5-4-10(17)6-9(11)8-18-2/h4-6,12-13,18H,3,7-8,17H2,1-2H3/t12-/m1/s1 |
| InChIKey | VMSYRLPWZFJTCD-GFCCVEGCSA-N |
| XLogP | 2.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|