C10H17N3 — CID 141451850
1-N,1-N-dimethyl-2-(methylaminomethyl)benzene-1,4-diamine (PubChem CID 141451850) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-N,1-N-dimethyl-2-(methylaminomethyl)benzene-1,4-diamine.
| Compound Name | 1-N,1-N-dimethyl-2-(methylaminomethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 141451850 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-N,1-N-dimethyl-2-(methylaminomethyl)benzene-1,4-diamine |
| SMILES | CNCc1cc(N)ccc1N(C)C |
| InChI | InChI=1S/C10H17N3/c1-12-7-8-6-9(11)4-5-10(8)13(2)3/h4-6,12H,7,11H2,1-3H3 |
| InChIKey | PPOREOMOFPDMHH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|