C20H22N2O3 — CID 11809905
(1R,15R,16R,17E)-17-ethylidene-15-(hydroxymethyl)-19-oxa-3,13-diazapentacyclo[14.3.1.01,13.02,10.04,9]icosa-2(10),4,6,8-tetraen-14-one (PubChem CID 11809905) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is (1R,15R,16R,17E)-17-ethylidene-15-(hydroxymethyl)-19-oxa-3,13-diazapentacyclo[14.3.1.01,13.02,10.04,9]icosa-2(10),4,6,8-tetraen-14-one.
| Compound Name | (1R,15R,16R,17E)-17-ethylidene-15-(hydroxymethyl)-19-oxa-3,13-diazapentacyclo[14.3.1.01,13.02,10.04,9]icosa-2(10),4,6,8-tetraen-14-one |
|---|---|
| PubChem CID | 11809905 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (1R,15R,16R,17E)-17-ethylidene-15-(hydroxymethyl)-19-oxa-3,13-diazapentacyclo[14.3.1.01,13.02,10.04,9]icosa-2(10),4,6,8-tetraen-14-one |
| SMILES | C/C=C1/CO[C@@]23C[C@@H]1[C@H](CO)C(=O)N2CCc1c3[nH]c2ccccc12 |
| InChI | InChI=1S/C20H22N2O3/c1-2-12-11-25-20-9-15(12)16(10-23)19(24)22(20)8-7-14-13-5-3-4-6-17(13)21-18(14)20/h2-6,15-16,21,23H,7-11H2,1H3/b12-2-/t15-,16-,20+/m0/s1 |
| InChIKey | KXRVCBUVJNQYRH-ZRTYVFEJSA-N |
| XLogP | 2.31 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|