C23H22ClN3O2 — CID 12863276
15-(3-chlorophenyl)-16-hydroxy-3,13,15-triazapentacyclo[11.7.0.01,16.02,10.04,9]icosa-2(10),4,6,8-tetraen-14-one (PubChem CID 12863276) has the molecular formula C23H22ClN3O2 and a molecular weight of 407.90 g/mol. Its IUPAC name is 15-(3-chlorophenyl)-16-hydroxy-3,13,15-triazapentacyclo[11.7.0.01,16.02,10.04,9]icosa-2(10),4,6,8-tetraen-14-one.
| Compound Name | 15-(3-chlorophenyl)-16-hydroxy-3,13,15-triazapentacyclo[11.7.0.01,16.02,10.04,9]icosa-2(10),4,6,8-tetraen-14-one |
|---|---|
| PubChem CID | 12863276 |
| Molecular Formula | C23H22ClN3O2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 15-(3-chlorophenyl)-16-hydroxy-3,13,15-triazapentacyclo[11.7.0.01,16.02,10.04,9]icosa-2(10),4,6,8-tetraen-14-one |
| SMILES | O=C1N(c2cccc(Cl)c2)C2(O)CCCCC23c2[nH]c4ccccc4c2CCN13 |
| InChI | InChI=1S/C23H22ClN3O2/c24-15-6-5-7-16(14-15)27-21(28)26-13-10-18-17-8-1-2-9-19(17)25-20(18)22(26)11-3-4-12-23(22,27)29/h1-2,5-9,14,25,29H,3-4,10-13H2 |
| InChIKey | AYSTWSNSQVXXHY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |