C17H17N5 — CID 10062877
3,13,15-triazapentacyclo[13.2.2.01,13.02,10.04,9]nonadeca-2(10),4,6,8-tetraen-14-ylidenecyanamide (PubChem CID 10062877) has the molecular formula C17H17N5 and a molecular weight of 291.36 g/mol. Its IUPAC name is 3,13,15-triazapentacyclo[13.2.2.01,13.02,10.04,9]nonadeca-2(10),4,6,8-tetraen-14-ylidenecyanamide.
| Compound Name | 3,13,15-triazapentacyclo[13.2.2.01,13.02,10.04,9]nonadeca-2(10),4,6,8-tetraen-14-ylidenecyanamide |
|---|---|
| PubChem CID | 10062877 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3,13,15-triazapentacyclo[13.2.2.01,13.02,10.04,9]nonadeca-2(10),4,6,8-tetraen-14-ylidenecyanamide |
| SMILES | N#C/N=C1\N2CCC3(CC2)c2[nH]c4ccccc4c2CCN13 |
| InChI | InChI=1S/C17H17N5/c18-11-19-16-21-9-6-17(7-10-21)15-13(5-8-22(16)17)12-3-1-2-4-14(12)20-15/h1-4,20H,5-10H2/b19-16+ |
| InChIKey | KTWRLTOXXXTUDY-KNTRCKAVSA-N |
| XLogP | 2.17 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|